C13H30N2Si — CID 123175979
1-[ethenyl(ethyl)silyl]-N,N,N',N'-tetraethylmethanediamine (PubChem CID 123175979) has the molecular formula C13H30N2Si and a molecular weight of 242.48 g/mol. Its IUPAC name is 1-[ethenyl(ethyl)silyl]-N,N,N',N'-tetraethylmethanediamine.
| Compound Name | 1-[ethenyl(ethyl)silyl]-N,N,N',N'-tetraethylmethanediamine |
|---|---|
| PubChem CID | 123175979 |
| Molecular Formula | C13H30N2Si |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-[ethenyl(ethyl)silyl]-N,N,N',N'-tetraethylmethanediamine |
| SMILES | C=C[SiH](CC)C(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C13H30N2Si/c1-7-14(8-2)13(15(9-3)10-4)16(11-5)12-6/h11,13,16H,5,7-10,12H2,1-4,6H3 |
| InChIKey | FPQUTOCZABKVPD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|