About N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine
N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine (PubChem CID 167115716) has the molecular formula C14H30N2S
and a molecular weight of 258.47 g/mol. Its IUPAC name is N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine.
Molecular Properties
| Compound Name | N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine |
| PubChem CID | 167115716 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine |
| SMILES | C=CS(C=C)(N(CC)C(C)C)N(CC)C(C)C |
| InChI | InChI=1S/C14H30N2S/c1-9-15(13(5)6)17(11-3,12-4)16(10-2)14(7)8/h11-14H,3-4,9-10H2,1-2,5-8H3 |
| InChIKey | MSUAANBJHGLKFL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine?
The IUPAC name of N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine (CID 167115716) is N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine.
What is the SMILES notation for N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine?
The canonical SMILES for N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine is C=CS(C=C)(N(CC)C(C)C)N(CC)C(C)C.
What is the InChIKey of N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine?
The InChIKey is MSUAANBJHGLKFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2S/c1-9-15(13(5)6)17(11-3,12-4)16(10-2)14(7)8/h11-14H,3-4,9-10H2,1-2,5-8H3.
What are the key properties of N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine?
N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine has a molecular weight of 258.47 g/mol, XLogP of 4.37, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(ethenyl)-[ethyl(propan-2-yl)amino]-λ4-sulfanyl]-N-ethylpropan-2-amine is sourced from PubChem (CID 167115716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).