C8H14O4S2 — CID 159569958
(3S)-2,3-bis(ethenylsulfonyl)butane (PubChem CID 159569958) has the molecular formula C8H14O4S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3S)-2,3-bis(ethenylsulfonyl)butane.
| Compound Name | (3S)-2,3-bis(ethenylsulfonyl)butane |
|---|---|
| PubChem CID | 159569958 |
| Molecular Formula | C8H14O4S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (3S)-2,3-bis(ethenylsulfonyl)butane |
| SMILES | C=CS(=O)(=O)C(C)[C@H](C)S(=O)(=O)C=C |
| InChI | InChI=1S/C8H14O4S2/c1-5-13(9,10)7(3)8(4)14(11,12)6-2/h5-8H,1-2H2,3-4H3/t7-,8?/m0/s1 |
| InChIKey | IOKAVWUQOZXNAM-JAMMHHFISA-N |
| XLogP | 0.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |