C8H13NO5S2 — CID 141157491
1,2-bis(ethenylsulfonyl)-2-(ethylamino)ethanone (PubChem CID 141157491) has the molecular formula C8H13NO5S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1,2-bis(ethenylsulfonyl)-2-(ethylamino)ethanone.
| Compound Name | 1,2-bis(ethenylsulfonyl)-2-(ethylamino)ethanone |
|---|---|
| PubChem CID | 141157491 |
| Molecular Formula | C8H13NO5S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 1,2-bis(ethenylsulfonyl)-2-(ethylamino)ethanone |
| SMILES | C=CS(=O)(=O)C(=O)C(NCC)S(=O)(=O)C=C |
| InChI | InChI=1S/C8H13NO5S2/c1-4-9-7(15(11,12)5-2)8(10)16(13,14)6-3/h5-7,9H,2-4H2,1H3 |
| InChIKey | URBCKIXIXJBSSQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|