C10H16O6S3 — CID 90813071
2-ethenylsulfonyl-1,3-bis(ethylsulfonyl)buta-1,3-diene (PubChem CID 90813071) has the molecular formula C10H16O6S3 and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-ethenylsulfonyl-1,3-bis(ethylsulfonyl)buta-1,3-diene.
| Compound Name | 2-ethenylsulfonyl-1,3-bis(ethylsulfonyl)buta-1,3-diene |
|---|---|
| PubChem CID | 90813071 |
| Molecular Formula | C10H16O6S3 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-ethenylsulfonyl-1,3-bis(ethylsulfonyl)buta-1,3-diene |
| SMILES | C=CS(=O)(=O)C(=CS(=O)(=O)CC)C(=C)S(=O)(=O)CC |
| InChI | InChI=1S/C10H16O6S3/c1-5-17(11,12)8-10(19(15,16)7-3)9(4)18(13,14)6-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | CYQKGHWZCKUVGX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|