C17H36N4O — CID 142113332
1,8,9,13-tetramethyl-1,5,9,13-tetrazacycloheptadecan-6-one (PubChem CID 142113332) has the molecular formula C17H36N4O and a molecular weight of 312.50 g/mol. Its IUPAC name is 1,8,9,13-tetramethyl-1,5,9,13-tetrazacycloheptadecan-6-one.
| Compound Name | 1,8,9,13-tetramethyl-1,5,9,13-tetrazacycloheptadecan-6-one |
|---|---|
| PubChem CID | 142113332 |
| Molecular Formula | C17H36N4O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | 1,8,9,13-tetramethyl-1,5,9,13-tetrazacycloheptadecan-6-one |
| SMILES | CC1CC(=O)NCCCN(C)CCCCN(C)CCCN1C |
| InChI | InChI=1S/C17H36N4O/c1-16-15-17(22)18-9-7-12-19(2)10-5-6-11-20(3)13-8-14-21(16)4/h16H,5-15H2,1-4H3,(H,18,22) |
| InChIKey | KWMCBILWAHVKDV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |