C13H31NO8S — CID 142114963
2-(2-ethoxyethoxy)ethanol;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]methanesulfonamide (PubChem CID 142114963) has the molecular formula C13H31NO8S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethanol;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]methanesulfonamide.
| Compound Name | 2-(2-ethoxyethoxy)ethanol;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 142114963 |
| Molecular Formula | C13H31NO8S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethanol;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]methanesulfonamide |
| SMILES | CCOCCOCCO.CS(=O)(=O)NCCOCCOCCO |
| InChI | InChI=1S/C7H17NO5S.C6H14O3/c1-14(10,11)8-2-4-12-6-7-13-5-3-9;1-2-8-5-6-9-4-3-7/h8-9H,2-7H2,1H3;7H,2-6H2,1H3 |
| InChIKey | XYEVXSHNBVVGRP-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|