C33H46F6N2O — CID 142115920
3-[3,5-bis(trifluoromethyl)phenyl]propanal;ethane;N-methyl-3-(4-phenylpiperidin-1-yl)-1-propylcyclopentan-1-amine (PubChem CID 142115920) has the molecular formula C33H46F6N2O and a molecular weight of 600.73 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]propanal;ethane;N-methyl-3-(4-phenylpiperidin-1-yl)-1-propylcyclopentan-1-amine.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]propanal;ethane;N-methyl-3-(4-phenylpiperidin-1-yl)-1-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 142115920 |
| Molecular Formula | C33H46F6N2O |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]propanal;ethane;N-methyl-3-(4-phenylpiperidin-1-yl)-1-propylcyclopentan-1-amine |
| SMILES | CC.CCCC1(NC)CCC(N2CCC(c3ccccc3)CC2)C1.O=CCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H32N2.C11H8F6O.C2H6/c1-3-12-20(21-2)13-9-19(16-20)22-14-10-18(11-15-22)17-7-5-4-6-8-17;12-10(13,14)8-4-7(2-1-3-18)5-9(6-8)11(15,16)17;1-2/h4-8,18-19,21H,3,9-16H2,1-2H3;3-6H,1-2H2;1-2H3 |
| InChIKey | NPSDPFWIAARCCZ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|