C23H33NO2 — CID 142115945
3-[3-methyl-4-[(Z)-2-phenylethenyl]piperidin-1-yl]-1-propylcyclopentane-1-carboxylic acid (PubChem CID 142115945) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 3-[3-methyl-4-[(Z)-2-phenylethenyl]piperidin-1-yl]-1-propylcyclopentane-1-carboxylic acid.
| Compound Name | 3-[3-methyl-4-[(Z)-2-phenylethenyl]piperidin-1-yl]-1-propylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 142115945 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3-[3-methyl-4-[(Z)-2-phenylethenyl]piperidin-1-yl]-1-propylcyclopentane-1-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCC(N2CCC(/C=C\c3ccccc3)C(C)C2)C1 |
| InChI | InChI=1S/C23H33NO2/c1-3-13-23(22(25)26)14-11-21(16-23)24-15-12-20(18(2)17-24)10-9-19-7-5-4-6-8-19/h4-10,18,20-21H,3,11-17H2,1-2H3,(H,25,26)/b10-9- |
| InChIKey | XJKIQHUHEHBLMH-KTKRTIGZSA-N |
| XLogP | 5.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |