C31H36NO2S+ — CID 142116514
(N-benzylanilino)-[[(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]sulfanium (PubChem CID 142116514) has the molecular formula C31H36NO2S+ and a molecular weight of 486.70 g/mol. Its IUPAC name is (N-benzylanilino)-[[(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]sulfanium.
| Compound Name | (N-benzylanilino)-[[(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]sulfanium |
|---|---|
| PubChem CID | 142116514 |
| Molecular Formula | C31H36NO2S+ |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | (N-benzylanilino)-[[(13S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]sulfanium |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC[C@H]2O[SH+]N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35NO2S/c1-31-19-18-27-26-15-13-25(33)20-23(26)12-14-28(27)29(31)16-17-30(31)34-35-32(24-10-6-3-7-11-24)21-22-8-4-2-5-9-22/h2-11,13,15,20,27-30,33H,12,14,16-19,21H2,1H3/p+1/t27?,28?,29?,30-,31+/m1/s1 |
| InChIKey | RCSQNAFMUJIKIM-MFUSSJNISA-O |
| XLogP | 6.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|