C20H25N5O2S — CID 142117485
ethane;1-(3-hydroxypiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone (PubChem CID 142117485) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is ethane;1-(3-hydroxypiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone.
| Compound Name | ethane;1-(3-hydroxypiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone |
|---|---|
| PubChem CID | 142117485 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | ethane;1-(3-hydroxypiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone |
| SMILES | CC.O=C(C(c1ccccc1)n1cnc2[nH]ncc2c1=S)N1CCCC(O)C1 |
| InChI | InChI=1S/C18H19N5O2S.C2H6/c24-13-7-4-8-22(10-13)17(25)15(12-5-2-1-3-6-12)23-11-19-16-14(18(23)26)9-20-21-16;1-2/h1-3,5-6,9,11,13,15,24H,4,7-8,10H2,(H,20,21);1-2H3 |
| InChIKey | LNGMLEMXQHHSKG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|