C20H23N5OS — CID 10177885
1-(azocan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone (PubChem CID 10177885) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-(azocan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone.
| Compound Name | 1-(azocan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone |
|---|---|
| PubChem CID | 10177885 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-(azocan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)n1cnc2[nH]ncc2c1=S)N1CCCCCCC1 |
| InChI | InChI=1S/C20H23N5OS/c26-19(24-11-7-2-1-3-8-12-24)17(15-9-5-4-6-10-15)25-14-21-18-16(20(25)27)13-22-23-18/h4-6,9-10,13-14,17H,1-3,7-8,11-12H2,(H,22,23) |
| InChIKey | RJGOMNANUZNDDS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|