C22H28N4O2S — CID 142117594
ethane;1-(4-hydroxy-4-methylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone (PubChem CID 142117594) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is ethane;1-(4-hydroxy-4-methylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone.
| Compound Name | ethane;1-(4-hydroxy-4-methylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 142117594 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | ethane;1-(4-hydroxy-4-methylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
| SMILES | CC.CC1(O)CCN(C(=O)C(c2ccccc2)n2ccc3[nH]ncc3c2=S)CC1 |
| InChI | InChI=1S/C20H22N4O2S.C2H6/c1-20(26)8-11-23(12-9-20)18(25)17(14-5-3-2-4-6-14)24-10-7-16-15(19(24)27)13-21-22-16;1-2/h2-7,10,13,17,26H,8-9,11-12H2,1H3,(H,21,22);1-2H3 |
| InChIKey | UEVNYWREXSDVRD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|