C17H17N5O2S — CID 169109612
1-morpholin-4-yl-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone (PubChem CID 169109612) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone.
| Compound Name | 1-morpholin-4-yl-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone |
|---|---|
| PubChem CID | 169109612 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-morpholin-4-yl-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)n1cnc2[nH]ncc2c1=S)N1CCOCC1 |
| InChI | InChI=1S/C17H17N5O2S/c23-16(21-6-8-24-9-7-21)14(12-4-2-1-3-5-12)22-11-18-15-13(17(22)25)10-19-20-15/h1-5,10-11,14H,6-9H2,(H,19,20) |
| InChIKey | FOMRMRDSHOJENR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|