C19H19IN4O2S — CID 142117611
[1-[2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)acetyl]piperidin-3-yl] hypoiodite (PubChem CID 142117611) has the molecular formula C19H19IN4O2S and a molecular weight of 494.36 g/mol. Its IUPAC name is [1-[2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)acetyl]piperidin-3-yl] hypoiodite.
| Compound Name | [1-[2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)acetyl]piperidin-3-yl] hypoiodite |
|---|---|
| PubChem CID | 142117611 |
| Molecular Formula | C19H19IN4O2S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | [1-[2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)acetyl]piperidin-3-yl] hypoiodite |
| SMILES | O=C(C(c1ccccc1)n1ccc2[nH]ncc2c1=S)N1CCCC(OI)C1 |
| InChI | InChI=1S/C19H19IN4O2S/c20-26-14-7-4-9-23(12-14)18(25)17(13-5-2-1-3-6-13)24-10-8-16-15(19(24)27)11-21-22-16/h1-3,5-6,8,10-11,14,17H,4,7,9,12H2,(H,21,22) |
| InChIKey | ZKUOOBYBFZWLBD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|