C19H21N5OSU — CID 142117595
1-(azepan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone;uranium (PubChem CID 142117595) has the molecular formula C19H21N5OSU and a molecular weight of 605.51 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone;uranium.
| Compound Name | 1-(azepan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone;uranium |
|---|---|
| PubChem CID | 142117595 |
| Molecular Formula | C19H21N5OSU |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 1-(azepan-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[5,4-d]pyrimidin-5-yl)ethanone;uranium |
| SMILES | O=C(C(c1ccccc1)n1cnc2[nH]ncc2c1=S)N1CCCCCC1.[U] |
| InChI | InChI=1S/C19H21N5OS.U/c25-18(23-10-6-1-2-7-11-23)16(14-8-4-3-5-9-14)24-13-20-17-15(19(24)26)12-21-22-17;/h3-5,8-9,12-13,16H,1-2,6-7,10-11H2,(H,21,22); |
| InChIKey | OTBOZQIROAUSRU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|