C21H24N6O — CID 59490810
2-phenyl-2-piperazin-1-yl-1-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)ethanone (PubChem CID 59490810) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-phenyl-2-piperazin-1-yl-1-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)ethanone.
| Compound Name | 2-phenyl-2-piperazin-1-yl-1-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)ethanone |
|---|---|
| PubChem CID | 59490810 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-phenyl-2-piperazin-1-yl-1-(3,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)N1CCNCC1)N1CCc2c(cnc3[nH]ncc23)C1 |
| InChI | InChI=1S/C21H24N6O/c28-21(19(15-4-2-1-3-5-15)26-10-7-22-8-11-26)27-9-6-17-16(14-27)12-23-20-18(17)13-24-25-20/h1-5,12-13,19,22H,6-11,14H2,(H,23,24,25) |
| InChIKey | JYGRLFPRGYDHQS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |