C18H17ClN4O — CID 90909155
2-chloro-1-(1-methyl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenylethanone (PubChem CID 90909155) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-chloro-1-(1-methyl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenylethanone.
| Compound Name | 2-chloro-1-(1-methyl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 90909155 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-chloro-1-(1-methyl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenylethanone |
| SMILES | Cc1[nH]nc2ncc3c(c12)CCN(C(=O)C(Cl)c1ccccc1)C3 |
| InChI | InChI=1S/C18H17ClN4O/c1-11-15-14-7-8-23(10-13(14)9-20-17(15)22-21-11)18(24)16(19)12-5-3-2-4-6-12/h2-6,9,16H,7-8,10H2,1H3,(H,20,21,22) |
| InChIKey | RDTCMUBOTWKUHL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|