C26H34N6O — CID 91186564
1-(1-pentan-2-yl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenyl-2-piperazin-1-ylethanone (PubChem CID 91186564) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-(1-pentan-2-yl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenyl-2-piperazin-1-ylethanone.
| Compound Name | 1-(1-pentan-2-yl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenyl-2-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 91186564 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 1-(1-pentan-2-yl-2,6,8,9-tetrahydropyrazolo[4,3-f][2,7]naphthyridin-7-yl)-2-phenyl-2-piperazin-1-ylethanone |
| SMILES | CCCC(C)c1[nH]nc2ncc3c(c12)CCN(C(=O)C(c1ccccc1)N1CCNCC1)C3 |
| InChI | InChI=1S/C26H34N6O/c1-3-7-18(2)23-22-21-10-13-32(17-20(21)16-28-25(22)30-29-23)26(33)24(19-8-5-4-6-9-19)31-14-11-27-12-15-31/h4-6,8-9,16,18,24,27H,3,7,10-15,17H2,1-2H3,(H,28,29,30) |
| InChIKey | FAFUBTFDDCPQKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |