C26H31N5O2S — CID 142117529
2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenylethanone;ethane (PubChem CID 142117529) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenylethanone;ethane.
| Compound Name | 2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenylethanone;ethane |
|---|---|
| PubChem CID | 142117529 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2-(4-amino-3-methanimidoyl-2-sulfanylidene-1-pyridinyl)-1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenylethanone;ethane |
| SMILES | CC.[H]/N=C/c1c(N)ccn(C(C(=O)N2CCC(O)(c3ccccn3)CC2)c2ccccc2)c1=S |
| InChI | InChI=1S/C24H25N5O2S.C2H6/c25-16-18-19(26)9-13-29(23(18)32)21(17-6-2-1-3-7-17)22(30)28-14-10-24(31,11-15-28)20-8-4-5-12-27-20;1-2/h1-9,12-13,16,21,25,31H,10-11,14-15,26H2;1-2H3/b25-16+; |
| InChIKey | FCKQTRPDNDLKOL-SRTPWMEPSA-N |
| XLogP | 4.32 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|