C19H25N5O — CID 142118141
8-amino-2-(cyclohexylamino)-6-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 142118141) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 8-amino-2-(cyclohexylamino)-6-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-amino-2-(cyclohexylamino)-6-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142118141 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 8-amino-2-(cyclohexylamino)-6-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C/C=C\C(=C/C)c1cc2cnc(NC3CCCCC3)nc2n(N)c1=O |
| InChI | InChI=1S/C19H25N5O/c1-3-8-13(4-2)16-11-14-12-21-19(22-15-9-6-5-7-10-15)23-17(14)24(20)18(16)25/h3-4,8,11-12,15H,5-7,9-10,20H2,1-2H3,(H,21,22,23)/b8-3-,13-4+ |
| InChIKey | DIXLZWKNRJHSEM-FDHJNFDVSA-N |
| XLogP | 3.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|