C27H42FNO — CID 142118148
ethane;(3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one;methylcyclohexane (PubChem CID 142118148) has the molecular formula C27H42FNO and a molecular weight of 415.64 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one;methylcyclohexane.
| Compound Name | ethane;(3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one;methylcyclohexane |
|---|---|
| PubChem CID | 142118148 |
| Molecular Formula | C27H42FNO |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | ethane;(3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one;methylcyclohexane |
| SMILES | C=CC(/C=C(\C(C)=O)C1=CC(C)C=C1F)=C(/C)N=C(C)C.CC.CC1CCCCC1 |
| InChI | InChI=1S/C18H22FNO.C7H14.C2H6/c1-7-15(13(5)20-11(2)3)10-16(14(6)21)17-8-12(4)9-18(17)19;1-7-5-3-2-4-6-7;1-2/h7-10,12H,1H2,2-6H3;7H,2-6H2,1H3;1-2H3/b15-13+,16-10+;; |
| InChIKey | GMWWOXXWSOFTRL-TWOFCNAISA-N |
| XLogP | 8.48 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|