C18H22FNO — CID 142118149
(3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one (PubChem CID 142118149) has the molecular formula C18H22FNO and a molecular weight of 287.38 g/mol. Its IUPAC name is (3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one.
| Compound Name | (3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 142118149 |
| Molecular Formula | C18H22FNO |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (3Z,5E)-5-ethenyl-3-(5-fluoro-3-methylcyclopenta-1,4-dien-1-yl)-6-(propan-2-ylideneamino)hepta-3,5-dien-2-one |
| SMILES | C=CC(/C=C(\C(C)=O)C1=CC(C)C=C1F)=C(/C)N=C(C)C |
| InChI | InChI=1S/C18H22FNO/c1-7-15(13(5)20-11(2)3)10-16(14(6)21)17-8-12(4)9-18(17)19/h7-10,12H,1H2,2-6H3/b15-13+,16-10+ |
| InChIKey | UIAQATXPWBJZHJ-SJKDQANVSA-N |
| XLogP | 4.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|