C20H25NO — CID 142918253
(2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one (PubChem CID 142918253) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is (2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one.
| Compound Name | (2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one |
|---|---|
| PubChem CID | 142918253 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one |
| SMILES | C/C=C\C=C(/CC)C(=O)C/C=C\C(\C=C\C1=CC=CC1)=N/C |
| InChI | InChI=1S/C20H25NO/c1-4-6-12-18(5-2)20(22)14-9-13-19(21-3)16-15-17-10-7-8-11-17/h4,6-10,12-13,15-16H,5,11,14H2,1-3H3/b6-4-,13-9-,16-15+,18-12+,21-19+ |
| InChIKey | JOLFBBXRCUJHLK-HTFHAFOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|