C19H29NO — CID 143766587
(3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one;ethane (PubChem CID 143766587) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one;ethane.
| Compound Name | (3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one;ethane |
|---|---|
| PubChem CID | 143766587 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one;ethane |
| SMILES | C/C=C\C=C/C=C(C)/C=C/C=C(C(C)=O)\C(C)=N\C.CC |
| InChI | InChI=1S/C17H23NO.C2H6/c1-6-7-8-9-11-14(2)12-10-13-17(16(4)19)15(3)18-5;1-2/h6-13H,1-5H3;1-2H3/b7-6-,9-8-,12-10+,14-11+,17-13+,18-15+; |
| InChIKey | WAUSFTNMPOEJMQ-CYZLFMFYSA-N |
| XLogP | 5.25 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|