C16H19NO — CID 142370830
(3E,5Z,7E)-3-ethyl-7-(6-iminocyclohexa-2,4-dien-1-ylidene)octa-3,5-dien-2-one (PubChem CID 142370830) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (3E,5Z,7E)-3-ethyl-7-(6-iminocyclohexa-2,4-dien-1-ylidene)octa-3,5-dien-2-one.
| Compound Name | (3E,5Z,7E)-3-ethyl-7-(6-iminocyclohexa-2,4-dien-1-ylidene)octa-3,5-dien-2-one |
|---|---|
| PubChem CID | 142370830 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (3E,5Z,7E)-3-ethyl-7-(6-iminocyclohexa-2,4-dien-1-ylidene)octa-3,5-dien-2-one |
| SMILES | [H]/N=C1\C=CC=C\C1=C(C)/C=C\C=C(/CC)C(C)=O |
| InChI | InChI=1S/C16H19NO/c1-4-14(13(3)18)9-7-8-12(2)15-10-5-6-11-16(15)17/h5-11,17H,4H2,1-3H3/b8-7-,14-9+,15-12+,17-16+ |
| InChIKey | RHVDRMPCICHOMX-DGCLEWBMSA-N |
| XLogP | 3.93 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|