C8H13NO — CID 142620524
(E)-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one (PubChem CID 142620524) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (E)-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one.
| Compound Name | (E)-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one |
|---|---|
| PubChem CID | 142620524 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (E)-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one |
| SMILES | C/C=C(C(C)=O)\C(C)=N\C |
| InChI | InChI=1S/C8H13NO/c1-5-8(7(3)10)6(2)9-4/h5H,1-4H3/b8-5+,9-6+ |
| InChIKey | XNYOWUGVWMCWFR-XVYDYJIPSA-N |
| XLogP | 1.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|