C9H10NOY- — CID 58194049
2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one;yttrium (PubChem CID 58194049) has the molecular formula C9H10NOY- and a molecular weight of 237.09 g/mol. Its IUPAC name is 2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one;yttrium.
| Compound Name | 2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one;yttrium |
|---|---|
| PubChem CID | 58194049 |
| Molecular Formula | C9H10NOY- |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | 2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one;yttrium |
| SMILES | C/N=C1/[C-]=C(C)C(=O)C(C)=C1.[Y] |
| InChI | InChI=1S/C9H10NO.Y/c1-6-4-8(10-3)5-7(2)9(6)11;/h4H,1-3H3;/q-1;/b10-8+; |
| InChIKey | GRWHAVHHXDMEBD-VRTOBVRTSA-N |
| XLogP | 1.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|