C10H14F3NO — CID 155718417
(E)-8,8,8-trifluoro-5-methyl-7-methyliminooct-5-en-4-one (PubChem CID 155718417) has the molecular formula C10H14F3NO and a molecular weight of 221.22 g/mol. Its IUPAC name is (E)-8,8,8-trifluoro-5-methyl-7-methyliminooct-5-en-4-one.
| Compound Name | (E)-8,8,8-trifluoro-5-methyl-7-methyliminooct-5-en-4-one |
|---|---|
| PubChem CID | 155718417 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (E)-8,8,8-trifluoro-5-methyl-7-methyliminooct-5-en-4-one |
| SMILES | CCCC(=O)/C(C)=C/C(=N\C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO/c1-4-5-8(15)7(2)6-9(14-3)10(11,12)13/h6H,4-5H2,1-3H3/b7-6+,14-9+ |
| InChIKey | LOOVSJUPIVGWJU-LYNMIIHYSA-N |
| XLogP | 2.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|