C9H11NO — CID 58194050
2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one (PubChem CID 58194050) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 58194050 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2,6-dimethyl-4-methyliminocyclohexa-2,5-dien-1-one |
| SMILES | CN=C1C=C(C)C(=O)C(C)=C1 |
| InChI | InChI=1S/C9H11NO/c1-6-4-8(10-3)5-7(2)9(6)11/h4-5H,1-3H3 |
| InChIKey | PSLXVBQEXHNCBO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|