C10H11NO — CID 90672886
2,6-dimethyl-3-tritio-2,3-dihydroindol-5-one (PubChem CID 90672886) has the molecular formula C10H11NO and a molecular weight of 163.21 g/mol. Its IUPAC name is 2,6-dimethyl-3-tritio-2,3-dihydroindol-5-one.
| Compound Name | 2,6-dimethyl-3-tritio-2,3-dihydroindol-5-one |
|---|---|
| PubChem CID | 90672886 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2,6-dimethyl-3-tritio-2,3-dihydroindol-5-one |
| SMILES | [3H]C1C2=CC(=O)C(C)=CC2=NC1C |
| InChI | InChI=1S/C10H11NO/c1-6-3-9-8(5-10(6)12)4-7(2)11-9/h3,5,7H,4H2,1-2H3/i4T |
| InChIKey | ZTXFLRBZYZRELA-IBTRZKOZSA-N |
| XLogP | 1.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|