C11H15NO — CID 22979279
2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one (PubChem CID 22979279) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 22979279 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2,3,5,6-tetramethyl-4-methyliminocyclohexa-2,5-dien-1-one |
| SMILES | CN=C1C(C)=C(C)C(=O)C(C)=C1C |
| InChI | InChI=1S/C11H15NO/c1-6-8(3)11(13)9(4)7(2)10(6)12-5/h1-5H3 |
| InChIKey | PLOFQIHUOIVYLG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|