C10H12NO- — CID 139249935
(2,3,4,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-ylidene)azanide (PubChem CID 139249935) has the molecular formula C10H12NO- and a molecular weight of 162.21 g/mol. Its IUPAC name is (2,3,4,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-ylidene)azanide.
| Compound Name | (2,3,4,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-ylidene)azanide |
|---|---|
| PubChem CID | 139249935 |
| Molecular Formula | C10H12NO- |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (2,3,4,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-ylidene)azanide |
| SMILES | CC1=C(C)C(C)=C(C)C(=O)C1=[N-] |
| InChI | InChI=1S/C10H12NO/c1-5-6(2)8(4)10(12)9(11)7(5)3/h1-4H3/q-1 |
| InChIKey | PJJPEBAKONSRQL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|