C10H13NO — CID 130029498
4-imino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-one (PubChem CID 130029498) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-imino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-imino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 130029498 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-imino-2,3,5,6-tetramethylcyclohexa-2,5-dien-1-one |
| SMILES | [H]N=C1C(C)=C(C)C(=O)C(C)=C1C |
| InChI | InChI=1S/C10H13NO/c1-5-7(3)10(12)8(4)6(2)9(5)11/h11H,1-4H3 |
| InChIKey | HGDCJYHRXODFCZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|