C8H9NO2 — CID 21360883
3,4,6-trimethylpyridine-2,5-dione (PubChem CID 21360883) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,4,6-trimethylpyridine-2,5-dione.
| Compound Name | 3,4,6-trimethylpyridine-2,5-dione |
|---|---|
| PubChem CID | 21360883 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3,4,6-trimethylpyridine-2,5-dione |
| SMILES | CC1=NC(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C8H9NO2/c1-4-5(2)8(11)9-6(3)7(4)10/h1-3H3 |
| InChIKey | SCOHMRKYMLTFQJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |