About 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone
1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone (PubChem CID 123840164) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone.
Analyze 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone?
The IUPAC name of 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone (CID 123840164) is 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone.
What is the SMILES notation for 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone?
The canonical SMILES for 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone is CC(=O)C1=C(C)CC(C)=NC1.
What is the InChIKey of 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone?
The InChIKey is YRBFUWLYBUFXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-4-7(2)10-5-9(6)8(3)11/h4-5H2,1-3H3.
What are the key properties of 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone?
1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone has a molecular weight of 151.21 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethyl-2,5-dihydropyridin-3-yl)ethanone is sourced from PubChem (CID 123840164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).