C8H11NO — CID 20652899
4,5,6-trimethyl-2H-pyridin-3-one (PubChem CID 20652899) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 4,5,6-trimethyl-2H-pyridin-3-one.
| Compound Name | 4,5,6-trimethyl-2H-pyridin-3-one |
|---|---|
| PubChem CID | 20652899 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 4,5,6-trimethyl-2H-pyridin-3-one |
| SMILES | CC1=NCC(=O)C(C)=C1C |
| InChI | InChI=1S/C8H11NO/c1-5-6(2)8(10)4-9-7(5)3/h4H2,1-3H3 |
| InChIKey | DFBVTUMUDGBZSU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |