C11H21NO — CID 143127939
3-(C,N-dimethylcarbonimidoyl)-4-methylpent-3-en-2-one;ethane (PubChem CID 143127939) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-4-methylpent-3-en-2-one;ethane.
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-4-methylpent-3-en-2-one;ethane |
|---|---|
| PubChem CID | 143127939 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-4-methylpent-3-en-2-one;ethane |
| SMILES | C/N=C(\C)C(C(C)=O)=C(C)C.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-6(2)9(8(4)11)7(3)10-5;1-2/h1-5H3;1-2H3/b10-7+; |
| InChIKey | JGRQOMJDZNAIQD-HCUGZAAXSA-N |
| XLogP | 3.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|