About 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal
2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal (PubChem CID 123185974) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal.
Molecular Properties
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal |
| PubChem CID | 123185974 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal |
| SMILES | CCCC(C)=C(C=O)/C(C)=N/C |
| InChI | InChI=1S/C10H17NO/c1-5-6-8(2)10(7-12)9(3)11-4/h7H,5-6H2,1-4H3/b10-8?,11-9+ |
| InChIKey | LSPAZURBZJRFQU-IZYRKSBPSA-N |
| XLogP | 2.39 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal?
The IUPAC name of 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal (CID 123185974) is 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal.
What is the SMILES notation for 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal?
The canonical SMILES for 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal is CCCC(C)=C(C=O)/C(C)=N/C.
What is the InChIKey of 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal?
The InChIKey is LSPAZURBZJRFQU-IZYRKSBPSA-N. The full InChI is InChI=1S/C10H17NO/c1-5-6-8(2)10(7-12)9(3)11-4/h7H,5-6H2,1-4H3/b10-8?,11-9+.
What are the key properties of 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal?
2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal has a molecular weight of 167.25 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(C,N-dimethylcarbonimidoyl)-3-methylhex-2-enal is sourced from PubChem (CID 123185974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).