C22H31NO — CID 142918252
(2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one;ethane (PubChem CID 142918252) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is (2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one;ethane.
| Compound Name | (2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one;ethane |
|---|---|
| PubChem CID | 142918252 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (2Z,4E,8Z,11E)-12-cyclopenta-1,3-dien-1-yl-5-ethyl-10-methyliminododeca-2,4,8,11-tetraen-6-one;ethane |
| SMILES | C/C=C\C=C(/CC)C(=O)C/C=C\C(\C=C\C1=CC=CC1)=N/C.CC |
| InChI | InChI=1S/C20H25NO.C2H6/c1-4-6-12-18(5-2)20(22)14-9-13-19(21-3)16-15-17-10-7-8-11-17;1-2/h4,6-10,12-13,15-16H,5,11,14H2,1-3H3;1-2H3/b6-4-,13-9-,16-15+,18-12+,21-19+; |
| InChIKey | JPAZOZUCPTYPMX-AZGXVCNGSA-N |
| XLogP | 5.95 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|