C20H32N2O2 — CID 142118284
tert-butyl 2-[(2-butan-2-ylanilino)methyl]pyrrolidine-1-carboxylate (PubChem CID 142118284) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl 2-[(2-butan-2-ylanilino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-butan-2-ylanilino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142118284 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | tert-butyl 2-[(2-butan-2-ylanilino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCC(C)c1ccccc1NCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O2/c1-6-15(2)17-11-7-8-12-18(17)21-14-16-10-9-13-22(16)19(23)24-20(3,4)5/h7-8,11-12,15-16,21H,6,9-10,13-14H2,1-5H3 |
| InChIKey | YXTXKZUHOVSFPS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |