C24H30O3 — CID 142118497
ethane;(4-ethylphenyl) 8-ethyl-8-methyl-5-oxo-6,7-dihydronaphthalene-2-carboxylate (PubChem CID 142118497) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is ethane;(4-ethylphenyl) 8-ethyl-8-methyl-5-oxo-6,7-dihydronaphthalene-2-carboxylate.
| Compound Name | ethane;(4-ethylphenyl) 8-ethyl-8-methyl-5-oxo-6,7-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 142118497 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | ethane;(4-ethylphenyl) 8-ethyl-8-methyl-5-oxo-6,7-dihydronaphthalene-2-carboxylate |
| SMILES | CC.CCc1ccc(OC(=O)c2ccc3c(c2)C(C)(CC)CCC3=O)cc1 |
| InChI | InChI=1S/C22H24O3.C2H6/c1-4-15-6-9-17(10-7-15)25-21(24)16-8-11-18-19(14-16)22(3,5-2)13-12-20(18)23;1-2/h6-11,14H,4-5,12-13H2,1-3H3;1-2H3 |
| InChIKey | SHEFGRXHFAUORT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|