C33H32O4 — CID 58895420
[7-[(4-ethylphenoxy)methoxy]-9,9-dimethylfluoren-2-yl] 4-ethylbenzoate (PubChem CID 58895420) has the molecular formula C33H32O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is [7-[(4-ethylphenoxy)methoxy]-9,9-dimethylfluoren-2-yl] 4-ethylbenzoate.
| Compound Name | [7-[(4-ethylphenoxy)methoxy]-9,9-dimethylfluoren-2-yl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 58895420 |
| Molecular Formula | C33H32O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | [7-[(4-ethylphenoxy)methoxy]-9,9-dimethylfluoren-2-yl] 4-ethylbenzoate |
| SMILES | CCc1ccc(OCOc2ccc3c(c2)C(C)(C)c2cc(OC(=O)c4ccc(CC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C33H32O4/c1-5-22-7-11-24(12-8-22)32(34)37-27-16-18-29-28-17-15-26(19-30(28)33(3,4)31(29)20-27)36-21-35-25-13-9-23(6-2)10-14-25/h7-20H,5-6,21H2,1-4H3 |
| InChIKey | XUFGIBZUPIAYJR-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|