C23H31F2N3O5 — CID 142118622
2-[[3-[[(3S)-3-(3,3-difluoropropyl)pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 142118622) has the molecular formula C23H31F2N3O5 and a molecular weight of 467.51 g/mol. Its IUPAC name is 2-[[3-[[(3S)-3-(3,3-difluoropropyl)pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[3-[[(3S)-3-(3,3-difluoropropyl)pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 142118622 |
| Molecular Formula | C23H31F2N3O5 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[[3-[[(3S)-3-(3,3-difluoropropyl)pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCCC(NC(=O)C1NCC[C@@H]1CCC(F)F)C(=O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H31F2N3O5/c1-2-6-16(27-21(30)19-15(11-12-26-19)9-10-18(24)25)20(29)22(31)28-17(23(32)33)13-14-7-4-3-5-8-14/h3-5,7-8,15-19,26H,2,6,9-13H2,1H3,(H,27,30)(H,28,31)(H,32,33)/t15-,16?,17?,19?/m0/s1 |
| InChIKey | YTMXWWCCMMILIW-KZIPQDEESA-N |
| XLogP | 1.68 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|