C31H30ClN7O — CID 142119697
4-[[[4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-hydroxymethyl]amino]benzonitrile (PubChem CID 142119697) has the molecular formula C31H30ClN7O and a molecular weight of 552.08 g/mol. Its IUPAC name is 4-[[[4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-hydroxymethyl]amino]benzonitrile.
| Compound Name | 4-[[[4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-hydroxymethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 142119697 |
| Molecular Formula | C31H30ClN7O |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 4-[[[4-[13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazin-1-yl]-hydroxymethyl]amino]benzonitrile |
| SMILES | Cc1nccn1CC1=Cc2cccnc2C(N2CCN(C(O)Nc3ccc(C#N)cc3)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C31H30ClN7O/c1-21-34-11-12-39(21)20-24-17-23-3-2-10-35-29(23)30(27-9-6-25(32)18-28(24)27)37-13-15-38(16-14-37)31(40)36-26-7-4-22(19-33)5-8-26/h2-12,17-18,30-31,36,40H,13-16,20H2,1H3 |
| InChIKey | ZYUBNRPKJDCMJU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|