C30H29BrClN7O — CID 89363276
N-(4-aminophenyl)-4-[6-bromo-13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide (PubChem CID 89363276) has the molecular formula C30H29BrClN7O and a molecular weight of 618.97 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-[6-bromo-13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-aminophenyl)-4-[6-bromo-13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 89363276 |
| Molecular Formula | C30H29BrClN7O |
| Molecular Weight | 618.97 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | N-(4-aminophenyl)-4-[6-bromo-13-chloro-10-[(2-methylimidazol-1-yl)methyl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxamide |
| SMILES | Cc1nccn1CC1=Cc2cc(Br)cnc2C(N2CCN(C(=O)Nc3ccc(N)cc3)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C30H29BrClN7O/c1-19-34-8-9-39(19)18-21-14-20-15-22(31)17-35-28(20)29(26-7-2-23(32)16-27(21)26)37-10-12-38(13-11-37)30(40)36-25-5-3-24(33)4-6-25/h2-9,14-17,29H,10-13,18,33H2,1H3,(H,36,40) |
| InChIKey | KGLWLDYESNHHER-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.97 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|