C20H20F5NO2 — CID 142121222
(4S)-4-[(4E,6Z,8E)-4-methyl-1,3-dioxonin-6-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyrrolidine (PubChem CID 142121222) has the molecular formula C20H20F5NO2 and a molecular weight of 401.38 g/mol. Its IUPAC name is (4S)-4-[(4E,6Z,8E)-4-methyl-1,3-dioxonin-6-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyrrolidine.
| Compound Name | (4S)-4-[(4E,6Z,8E)-4-methyl-1,3-dioxonin-6-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 142121222 |
| Molecular Formula | C20H20F5NO2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (4S)-4-[(4E,6Z,8E)-4-methyl-1,3-dioxonin-6-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyrrolidine |
| SMILES | C/C1=C\C([C@H]2CNC(c3ccc(C(F)(F)C(F)(F)F)cc3)C2)=C/C=C/OCO1 |
| InChI | InChI=1S/C20H20F5NO2/c1-13-9-15(3-2-8-27-12-28-13)16-10-18(26-11-16)14-4-6-17(7-5-14)19(21,22)20(23,24)25/h2-9,16,18,26H,10-12H2,1H3/b8-2+,13-9+,15-3+/t16-,18?/m1/s1 |
| InChIKey | LEPDIWBKDPMJNH-IPUCTXKLSA-N |
| XLogP | 5.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|