C13H15F4NO2 — CID 134920705
(Z)-1,3,3,3-tetrafluoro-2-(methoxymethoxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine (PubChem CID 134920705) has the molecular formula C13H15F4NO2 and a molecular weight of 293.26 g/mol. Its IUPAC name is (Z)-1,3,3,3-tetrafluoro-2-(methoxymethoxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine.
| Compound Name | (Z)-1,3,3,3-tetrafluoro-2-(methoxymethoxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 134920705 |
| Molecular Formula | C13H15F4NO2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (Z)-1,3,3,3-tetrafluoro-2-(methoxymethoxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine |
| SMILES | COCO/C(=C(\F)N[C@H](C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F4NO2/c1-9(10-6-4-3-5-7-10)18-12(14)11(13(15,16)17)20-8-19-2/h3-7,9,18H,8H2,1-2H3/b12-11+/t9-/m1/s1 |
| InChIKey | ZKPKMHCFKRGFFT-JFJDQEMCSA-N |
| XLogP | 3.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|