C16H19F4NO2 — CID 134920831
(Z)-1,3,3,3-tetrafluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine (PubChem CID 134920831) has the molecular formula C16H19F4NO2 and a molecular weight of 333.32 g/mol. Its IUPAC name is (Z)-1,3,3,3-tetrafluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine.
| Compound Name | (Z)-1,3,3,3-tetrafluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 134920831 |
| Molecular Formula | C16H19F4NO2 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (Z)-1,3,3,3-tetrafluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-amine |
| SMILES | C[C@@H](N/C(F)=C(/OC1CCCCO1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H19F4NO2/c1-11(12-7-3-2-4-8-12)21-15(17)14(16(18,19)20)23-13-9-5-6-10-22-13/h2-4,7-8,11,13,21H,5-6,9-10H2,1H3/b15-14+/t11-,13?/m1/s1 |
| InChIKey | ZHHUGGKBSILDHB-ZAULHCKWSA-N |
| XLogP | 4.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|