C16H18F3NO2 — CID 134920916
3,3,3-trifluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-imine (PubChem CID 134920916) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-imine.
| Compound Name | 3,3,3-trifluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-imine |
|---|---|
| PubChem CID | 134920916 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3,3,3-trifluoro-2-(oxan-2-yloxy)-N-[(1R)-1-phenylethyl]prop-1-en-1-imine |
| SMILES | C[C@@H](N=C=C(OC1CCCCO1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H18F3NO2/c1-12(13-7-3-2-4-8-13)20-11-14(16(17,18)19)22-15-9-5-6-10-21-15/h2-4,7-8,12,15H,5-6,9-10H2,1H3/t12-,15?/m1/s1 |
| InChIKey | JKAZHLPPIHYIBA-KEKZHRQWSA-N |
| XLogP | 4.41 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|